C11H9F6NOS — CID 59713047
S-[2,4-bis(trifluoromethyl)phenyl] N,N-dimethylcarbamothioate (PubChem CID 59713047) has the molecular formula C11H9F6NOS and a molecular weight of 317.25 g/mol. Its IUPAC name is S-[2,4-bis(trifluoromethyl)phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[2,4-bis(trifluoromethyl)phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 59713047 |
| Molecular Formula | C11H9F6NOS |
| Molecular Weight | 317.25 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | S-[2,4-bis(trifluoromethyl)phenyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)Sc1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C11H9F6NOS/c1-18(2)9(19)20-8-4-3-6(10(12,13)14)5-7(8)11(15,16)17/h3-5H,1-2H3 |
| InChIKey | MTXZUDSEBJEUOQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.25 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|