C23H23F3N4O2 — CID 59715947
(E)-3-[3-[1-(1-ethylpiperidin-3-yl)-4,6,7-trifluorobenzimidazol-2-yl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 59715947) has the molecular formula C23H23F3N4O2 and a molecular weight of 444.46 g/mol. Its IUPAC name is (E)-3-[3-[1-(1-ethylpiperidin-3-yl)-4,6,7-trifluorobenzimidazol-2-yl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[3-[1-(1-ethylpiperidin-3-yl)-4,6,7-trifluorobenzimidazol-2-yl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 59715947 |
| Molecular Formula | C23H23F3N4O2 |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | (E)-3-[3-[1-(1-ethylpiperidin-3-yl)-4,6,7-trifluorobenzimidazol-2-yl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | CCN1CCCC(n2c(-c3cccc(/C=C/C(=O)NO)c3)nc3c(F)cc(F)c(F)c32)C1 |
| InChI | InChI=1S/C23H23F3N4O2/c1-2-29-10-4-7-16(13-29)30-22-20(26)17(24)12-18(25)21(22)27-23(30)15-6-3-5-14(11-15)8-9-19(31)28-32/h3,5-6,8-9,11-12,16,32H,2,4,7,10,13H2,1H3,(H,28,31)/b9-8+ |
| InChIKey | QQBQBMQQYYTXLB-CMDGGOBGSA-N |
| XLogP | 4.30 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|