C31H62O4Si2 — CID 59719066
methyl 7-[(1R,2R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(4-methylpent-4-enyl)cyclopentyl]heptanoate (PubChem CID 59719066) has the molecular formula C31H62O4Si2 and a molecular weight of 555.01 g/mol. Its IUPAC name is methyl 7-[(1R,2R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(4-methylpent-4-enyl)cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(4-methylpent-4-enyl)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 59719066 |
| Molecular Formula | C31H62O4Si2 |
| Molecular Weight | 555.01 g/mol |
| Exact Mass | 554.42 |
| IUPAC Name | methyl 7-[(1R,2R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-(4-methylpent-4-enyl)cyclopentyl]heptanoate |
| SMILES | C=C(C)CCC[C@H]1C(O[Si](C)(C)C(C)(C)C)CC(O[Si](C)(C)C(C)(C)C)[C@@H]1CCCCCCC(=O)OC |
| InChI | InChI=1S/C31H62O4Si2/c1-24(2)19-18-21-26-25(20-16-14-15-17-22-29(32)33-9)27(34-36(10,11)30(3,4)5)23-28(26)35-37(12,13)31(6,7)8/h25-28H,1,14-23H2,2-13H3/t25-,26-,27?,28?/m1/s1 |
| InChIKey | AHCNKMYGGNTINB-XPALAHHGSA-N |
| XLogP | 9.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.01 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|