C24H14F7LiO8S — CID 59724379
lithium 2-[4-[1,1-bis(4-carboxyphenyl)-2,2,2-trifluoroethyl]phenoxy]-1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 59724379) has the molecular formula C24H14F7LiO8S and a molecular weight of 602.36 g/mol. Its IUPAC name is lithium 2-[4-[1,1-bis(4-carboxyphenyl)-2,2,2-trifluoroethyl]phenoxy]-1,1,2,2-tetrafluoroethanesulfonate.
| Compound Name | lithium 2-[4-[1,1-bis(4-carboxyphenyl)-2,2,2-trifluoroethyl]phenoxy]-1,1,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 59724379 |
| Molecular Formula | C24H14F7LiO8S |
| Molecular Weight | 602.36 g/mol |
| Exact Mass | 602.05 |
| IUPAC Name | lithium 2-[4-[1,1-bis(4-carboxyphenyl)-2,2,2-trifluoroethyl]phenoxy]-1,1,2,2-tetrafluoroethanesulfonate |
| SMILES | O=C(O)c1ccc(C(c2ccc(OC(F)(F)C(F)(F)S(=O)(=O)[O-])cc2)(c2ccc(C(=O)O)cc2)C(F)(F)F)cc1.[Li+] |
| InChI | InChI=1S/C24H15F7O8S.Li/c25-22(26,27)21(15-5-1-13(2-6-15)19(32)33,16-7-3-14(4-8-16)20(34)35)17-9-11-18(12-10-17)39-23(28,29)24(30,31)40(36,37)38;/h1-12H,(H,32,33)(H,34,35)(H,36,37,38);/q;+1/p-1 |
| InChIKey | FJVKINAAZYRPSB-UHFFFAOYSA-M |
| XLogP | 2.09 |
| TPSA | 141.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|