C46H51N7O9 — CID 59725531
methyl 3-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxo-4-(tritylamino)butanoyl]amino]-4-[[3-hydroxy-1-oxo-1-(2-oxopropylamino)butan-2-yl]amino]-4-oxobutanoate (PubChem CID 59725531) has the molecular formula C46H51N7O9 and a molecular weight of 845.95 g/mol. Its IUPAC name is methyl 3-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxo-4-(tritylamino)butanoyl]amino]-4-[[3-hydroxy-1-oxo-1-(2-oxopropylamino)butan-2-yl]amino]-4-oxobutanoate.
| Compound Name | methyl 3-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxo-4-(tritylamino)butanoyl]amino]-4-[[3-hydroxy-1-oxo-1-(2-oxopropylamino)butan-2-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 59725531 |
| Molecular Formula | C46H51N7O9 |
| Molecular Weight | 845.95 g/mol |
| Exact Mass | 845.37 |
| IUPAC Name | methyl 3-[[2-[[2-amino-3-(1H-indol-3-yl)propanoyl]amino]-4-oxo-4-(tritylamino)butanoyl]amino]-4-[[3-hydroxy-1-oxo-1-(2-oxopropylamino)butan-2-yl]amino]-4-oxobutanoate |
| SMILES | COC(=O)CC(NC(=O)C(CC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)NC(C(=O)NCC(C)=O)C(C)O |
| InChI | InChI=1S/C46H51N7O9/c1-28(54)26-49-45(61)41(29(2)55)52-44(60)38(25-40(57)62-3)51-43(59)37(50-42(58)35(47)23-30-27-48-36-22-14-13-21-34(30)36)24-39(56)53-46(31-15-7-4-8-16-31,32-17-9-5-10-18-32)33-19-11-6-12-20-33/h4-22,27,29,35,37-38,41,48,55H,23-26,47H2,1-3H3,(H,49,61)(H,50,58)(H,51,59)(H,52,60)(H,53,56) |
| InChIKey | OSBINQZEEHPQBC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 250.91 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.95 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|