C8H13NO3 — CID 59734330
(4S)-4-[(2-oxo-2-tritioethyl)amino]hexane-2,3-dione (PubChem CID 59734330) has the molecular formula C8H13NO3 and a molecular weight of 173.20 g/mol. Its IUPAC name is (4S)-4-[(2-oxo-2-tritioethyl)amino]hexane-2,3-dione.
| Compound Name | (4S)-4-[(2-oxo-2-tritioethyl)amino]hexane-2,3-dione |
|---|---|
| PubChem CID | 59734330 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 173.20 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | (4S)-4-[(2-oxo-2-tritioethyl)amino]hexane-2,3-dione |
| SMILES | [3H]C(=O)CN[C@@H](CC)C(=O)C(C)=O |
| InChI | InChI=1S/C8H13NO3/c1-3-7(9-4-5-10)8(12)6(2)11/h5,7,9H,3-4H2,1-2H3/t7-/m0/s1/i5T |
| InChIKey | GPCDECURNVHOOJ-AJDSPMCNSA-N |
| XLogP | -0.29 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.20 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|