C16H27F3O4Si — CID 59734884
tert-butyl 6-[dimethoxy(methyl)silyl]-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 59734884) has the molecular formula C16H27F3O4Si and a molecular weight of 368.47 g/mol. Its IUPAC name is tert-butyl 6-[dimethoxy(methyl)silyl]-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | tert-butyl 6-[dimethoxy(methyl)silyl]-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 59734884 |
| Molecular Formula | C16H27F3O4Si |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | tert-butyl 6-[dimethoxy(methyl)silyl]-2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CO[Si](C)(OC)C1CC2CC1C(C(=O)OC(C)(C)C)(C(F)(F)F)C2 |
| InChI | InChI=1S/C16H27F3O4Si/c1-14(2,3)23-13(20)15(16(17,18)19)9-10-7-11(15)12(8-10)24(6,21-4)22-5/h10-12H,7-9H2,1-6H3 |
| InChIKey | DDEGOJWVUKGHKV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|