About tert-butyl 2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;triethoxy(methyl)silane
tert-butyl 2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;triethoxy(methyl)silane (PubChem CID 160615125) has the molecular formula C20H37F3O5Si
and a molecular weight of 442.59 g/mol. Its IUPAC name is tert-butyl 2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;triethoxy(methyl)silane.
Molecular Properties
| Compound Name | tert-butyl 2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;triethoxy(methyl)silane |
| PubChem CID | 160615125 |
| Molecular Formula | C20H37F3O5Si |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | tert-butyl 2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;triethoxy(methyl)silane |
| SMILES | CC(C)(C)OC(=O)C1(C(F)(F)F)CC2CCC1C2.CCO[Si](C)(OCC)OCC |
| InChI | InChI=1S/C13H19F3O2.C7H18O3Si/c1-11(2,3)18-10(17)12(13(14,15)16)7-8-4-5-9(12)6-8;1-5-8-11(4,9-6-2)10-7-3/h8-9H,4-7H2,1-3H3;5-7H2,1-4H3 |
| InChIKey | RFZJJBLEQIDVSS-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;triethoxy(methyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;triethoxy(methyl)silane?
The IUPAC name of tert-butyl 2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;triethoxy(methyl)silane (CID 160615125) is tert-butyl 2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;triethoxy(methyl)silane.
What is the SMILES notation for tert-butyl 2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;triethoxy(methyl)silane?
The canonical SMILES for tert-butyl 2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;triethoxy(methyl)silane is CC(C)(C)OC(=O)C1(C(F)(F)F)CC2CCC1C2.CCO[Si](C)(OCC)OCC.
What is the InChIKey of tert-butyl 2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;triethoxy(methyl)silane?
The InChIKey is RFZJJBLEQIDVSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19F3O2.C7H18O3Si/c1-11(2,3)18-10(17)12(13(14,15)16)7-8-4-5-9(12)6-8;1-5-8-11(4,9-6-2)10-7-3/h8-9H,4-7H2,1-3H3;5-7H2,1-4H3.
What are the key properties of tert-butyl 2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;triethoxy(methyl)silane?
tert-butyl 2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;triethoxy(methyl)silane has a molecular weight of 442.59 g/mol, XLogP of 5.36, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;triethoxy(methyl)silane is sourced from PubChem (CID 160615125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).