C20H37F3O5Si — CID 160615125
tert-butyl 2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;triethoxy(methyl)silane (PubChem CID 160615125) has the molecular formula C20H37F3O5Si and a molecular weight of 442.59 g/mol. Its IUPAC name is tert-butyl 2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;triethoxy(methyl)silane.
| Compound Name | tert-butyl 2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;triethoxy(methyl)silane |
|---|---|
| PubChem CID | 160615125 |
| Molecular Formula | C20H37F3O5Si |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | tert-butyl 2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;triethoxy(methyl)silane |
| SMILES | CC(C)(C)OC(=O)C1(C(F)(F)F)CC2CCC1C2.CCO[Si](C)(OCC)OCC |
| InChI | InChI=1S/C13H19F3O2.C7H18O3Si/c1-11(2,3)18-10(17)12(13(14,15)16)7-8-4-5-9(12)6-8;1-5-8-11(4,9-6-2)10-7-3/h8-9H,4-7H2,1-3H3;5-7H2,1-4H3 |
| InChIKey | RFZJJBLEQIDVSS-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|