C29H44F4O5 — CID 58779921
2-[1-fluoro-5-hydroperoxy-3,4-dimethyl-5-(2-methyl-2-adamantyl)pentan-2-yl]oxyethyl 2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 58779921) has the molecular formula C29H44F4O5 and a molecular weight of 548.66 g/mol. Its IUPAC name is 2-[1-fluoro-5-hydroperoxy-3,4-dimethyl-5-(2-methyl-2-adamantyl)pentan-2-yl]oxyethyl 2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | 2-[1-fluoro-5-hydroperoxy-3,4-dimethyl-5-(2-methyl-2-adamantyl)pentan-2-yl]oxyethyl 2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 58779921 |
| Molecular Formula | C29H44F4O5 |
| Molecular Weight | 548.66 g/mol |
| Exact Mass | 548.31 |
| IUPAC Name | 2-[1-fluoro-5-hydroperoxy-3,4-dimethyl-5-(2-methyl-2-adamantyl)pentan-2-yl]oxyethyl 2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | CC(C(CF)OCCOC(=O)C1(C(F)(F)F)CC2CCC1C2)C(C)C(OO)C1(C)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C29H44F4O5/c1-16(17(2)25(38-35)27(3)22-10-19-8-20(12-22)13-23(27)11-19)24(15-30)36-6-7-37-26(34)28(29(31,32)33)14-18-4-5-21(28)9-18/h16-25,35H,4-15H2,1-3H3 |
| InChIKey | RHUZWJFTWQOZSW-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.66 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|