C22H23ClN4O3S — CID 59737323
2-(dimethylamino)ethyl N-[4-[[2-amino-5-(5-chlorothiophen-2-yl)phenyl]carbamoyl]phenyl]carbamate (PubChem CID 59737323) has the molecular formula C22H23ClN4O3S and a molecular weight of 458.97 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl N-[4-[[2-amino-5-(5-chlorothiophen-2-yl)phenyl]carbamoyl]phenyl]carbamate.
| Compound Name | 2-(dimethylamino)ethyl N-[4-[[2-amino-5-(5-chlorothiophen-2-yl)phenyl]carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 59737323 |
| Molecular Formula | C22H23ClN4O3S |
| Molecular Weight | 458.97 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | 2-(dimethylamino)ethyl N-[4-[[2-amino-5-(5-chlorothiophen-2-yl)phenyl]carbamoyl]phenyl]carbamate |
| SMILES | CN(C)CCOC(=O)Nc1ccc(C(=O)Nc2cc(-c3ccc(Cl)s3)ccc2N)cc1 |
| InChI | InChI=1S/C22H23ClN4O3S/c1-27(2)11-12-30-22(29)25-16-6-3-14(4-7-16)21(28)26-18-13-15(5-8-17(18)24)19-9-10-20(23)31-19/h3-10,13H,11-12,24H2,1-2H3,(H,25,29)(H,26,28) |
| InChIKey | QPHJPUGKZRKBTC-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.97 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|