C22H24N4O3S — CID 69101191
2-(dimethylamino)ethyl N-[4-[(2-amino-5-thiophen-3-ylphenyl)carbamoyl]phenyl]carbamate (PubChem CID 69101191) has the molecular formula C22H24N4O3S and a molecular weight of 424.53 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl N-[4-[(2-amino-5-thiophen-3-ylphenyl)carbamoyl]phenyl]carbamate.
| Compound Name | 2-(dimethylamino)ethyl N-[4-[(2-amino-5-thiophen-3-ylphenyl)carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 69101191 |
| Molecular Formula | C22H24N4O3S |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | 2-(dimethylamino)ethyl N-[4-[(2-amino-5-thiophen-3-ylphenyl)carbamoyl]phenyl]carbamate |
| SMILES | CN(C)CCOC(=O)Nc1ccc(C(=O)Nc2cc(-c3ccsc3)ccc2N)cc1 |
| InChI | InChI=1S/C22H24N4O3S/c1-26(2)10-11-29-22(28)24-18-6-3-15(4-7-18)21(27)25-20-13-16(5-8-19(20)23)17-9-12-30-14-17/h3-9,12-14H,10-11,23H2,1-2H3,(H,24,28)(H,25,27) |
| InChIKey | QQCSULYXIWTVHE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|