C24H28N4OS — CID 174575858
N-(2-amino-5-thiophen-3-ylphenyl)-4-[(4R)-4-(dimethylamino)-2-iminopentyl]benzamide (PubChem CID 174575858) has the molecular formula C24H28N4OS and a molecular weight of 420.58 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-3-ylphenyl)-4-[(4R)-4-(dimethylamino)-2-iminopentyl]benzamide.
| Compound Name | N-(2-amino-5-thiophen-3-ylphenyl)-4-[(4R)-4-(dimethylamino)-2-iminopentyl]benzamide |
|---|---|
| PubChem CID | 174575858 |
| Molecular Formula | C24H28N4OS |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | N-(2-amino-5-thiophen-3-ylphenyl)-4-[(4R)-4-(dimethylamino)-2-iminopentyl]benzamide |
| SMILES | [H]/N=C(/Cc1ccc(C(=O)Nc2cc(-c3ccsc3)ccc2N)cc1)C[C@@H](C)N(C)C |
| InChI | InChI=1S/C24H28N4OS/c1-16(28(2)3)12-21(25)13-17-4-6-18(7-5-17)24(29)27-23-14-19(8-9-22(23)26)20-10-11-30-15-20/h4-11,14-16,25H,12-13,26H2,1-3H3,(H,27,29)/b25-21+/t16-/m1/s1 |
| InChIKey | MRHIEZAGQIQCBO-VRCPTZKISA-N |
| XLogP | 5.15 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|