C26H30N4O — CID 174575983
N-(5-amino-2-phenylphenyl)-4-[(4R)-4-(dimethylamino)-2-iminopentyl]benzamide (PubChem CID 174575983) has the molecular formula C26H30N4O and a molecular weight of 414.55 g/mol. Its IUPAC name is N-(5-amino-2-phenylphenyl)-4-[(4R)-4-(dimethylamino)-2-iminopentyl]benzamide.
| Compound Name | N-(5-amino-2-phenylphenyl)-4-[(4R)-4-(dimethylamino)-2-iminopentyl]benzamide |
|---|---|
| PubChem CID | 174575983 |
| Molecular Formula | C26H30N4O |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | N-(5-amino-2-phenylphenyl)-4-[(4R)-4-(dimethylamino)-2-iminopentyl]benzamide |
| SMILES | [H]/N=C(/Cc1ccc(C(=O)Nc2cc(N)ccc2-c2ccccc2)cc1)C[C@@H](C)N(C)C |
| InChI | InChI=1S/C26H30N4O/c1-18(30(2)3)15-23(28)16-19-9-11-21(12-10-19)26(31)29-25-17-22(27)13-14-24(25)20-7-5-4-6-8-20/h4-14,17-18,28H,15-16,27H2,1-3H3,(H,29,31)/b28-23+/t18-/m1/s1 |
| InChIKey | WWAJHVUKLPAZTR-ZGYZAJHOSA-N |
| XLogP | 5.09 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|