C27H32N4OS — CID 174590649
N-(2-amino-5-thiophen-2-ylphenyl)-4-[(3S)-3-ethyl-2,5-diiminooctyl]benzamide (PubChem CID 174590649) has the molecular formula C27H32N4OS and a molecular weight of 460.65 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-2-ylphenyl)-4-[(3S)-3-ethyl-2,5-diiminooctyl]benzamide.
| Compound Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[(3S)-3-ethyl-2,5-diiminooctyl]benzamide |
|---|---|
| PubChem CID | 174590649 |
| Molecular Formula | C27H32N4OS |
| Molecular Weight | 460.65 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | N-(2-amino-5-thiophen-2-ylphenyl)-4-[(3S)-3-ethyl-2,5-diiminooctyl]benzamide |
| SMILES | [H]/N=C(/Cc1ccc(C(=O)Nc2cc(-c3cccs3)ccc2N)cc1)[C@@H](CC)C/C(CCC)=N/[H] |
| InChI | InChI=1S/C27H32N4OS/c1-3-6-22(28)16-19(4-2)24(30)15-18-8-10-20(11-9-18)27(32)31-25-17-21(12-13-23(25)29)26-7-5-14-33-26/h5,7-14,17,19,28,30H,3-4,6,15-16,29H2,1-2H3,(H,31,32)/b28-22+,30-24-/t19-/m0/s1 |
| InChIKey | OYNQNDHXMSSGTB-QVOQQCRGSA-N |
| XLogP | 7.05 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.65 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|