C29H28N4O4S — CID 24753578
[(2S)-3-[4-[(2-amino-5-thiophen-3-ylphenyl)carbamoyl]phenyl]-1-(methylamino)-1-oxopropan-2-yl]-benzylcarbamic acid (PubChem CID 24753578) has the molecular formula C29H28N4O4S and a molecular weight of 528.63 g/mol. Its IUPAC name is [(2S)-3-[4-[(2-amino-5-thiophen-3-ylphenyl)carbamoyl]phenyl]-1-(methylamino)-1-oxopropan-2-yl]-benzylcarbamic acid.
| Compound Name | [(2S)-3-[4-[(2-amino-5-thiophen-3-ylphenyl)carbamoyl]phenyl]-1-(methylamino)-1-oxopropan-2-yl]-benzylcarbamic acid |
|---|---|
| PubChem CID | 24753578 |
| Molecular Formula | C29H28N4O4S |
| Molecular Weight | 528.63 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | [(2S)-3-[4-[(2-amino-5-thiophen-3-ylphenyl)carbamoyl]phenyl]-1-(methylamino)-1-oxopropan-2-yl]-benzylcarbamic acid |
| SMILES | CNC(=O)[C@H](Cc1ccc(C(=O)Nc2cc(-c3ccsc3)ccc2N)cc1)N(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C29H28N4O4S/c1-31-28(35)26(33(29(36)37)17-20-5-3-2-4-6-20)15-19-7-9-21(10-8-19)27(34)32-25-16-22(11-12-24(25)30)23-13-14-38-18-23/h2-14,16,18,26H,15,17,30H2,1H3,(H,31,35)(H,32,34)(H,36,37)/t26-/m0/s1 |
| InChIKey | TYODONQJPYPOCG-SANMLTNESA-N |
| XLogP | 5.09 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.63 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|