C22H24N4O4S2 — CID 24753767
N-(2-amino-5-thiophen-3-ylphenyl)-4-[3-(methanesulfonamido)-1-(methylamino)-1-oxopropan-2-yl]benzamide (PubChem CID 24753767) has the molecular formula C22H24N4O4S2 and a molecular weight of 472.59 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-3-ylphenyl)-4-[3-(methanesulfonamido)-1-(methylamino)-1-oxopropan-2-yl]benzamide.
| Compound Name | N-(2-amino-5-thiophen-3-ylphenyl)-4-[3-(methanesulfonamido)-1-(methylamino)-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 24753767 |
| Molecular Formula | C22H24N4O4S2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | N-(2-amino-5-thiophen-3-ylphenyl)-4-[3-(methanesulfonamido)-1-(methylamino)-1-oxopropan-2-yl]benzamide |
| SMILES | CNC(=O)C(CNS(C)(=O)=O)c1ccc(C(=O)Nc2cc(-c3ccsc3)ccc2N)cc1 |
| InChI | InChI=1S/C22H24N4O4S2/c1-24-22(28)18(12-25-32(2,29)30)14-3-5-15(6-4-14)21(27)26-20-11-16(7-8-19(20)23)17-9-10-31-13-17/h3-11,13,18,25H,12,23H2,1-2H3,(H,24,28)(H,26,27) |
| InChIKey | UBHFNTLZKNYJIK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|