C24H22N3O2PS — CID 143614084
N-(2-amino-5-thiophen-3-ylphenyl)-6-[[methoxy(phenyl)phosphanyl]methyl]pyridine-3-carboxamide (PubChem CID 143614084) has the molecular formula C24H22N3O2PS and a molecular weight of 447.50 g/mol. Its IUPAC name is N-(2-amino-5-thiophen-3-ylphenyl)-6-[[methoxy(phenyl)phosphanyl]methyl]pyridine-3-carboxamide.
| Compound Name | N-(2-amino-5-thiophen-3-ylphenyl)-6-[[methoxy(phenyl)phosphanyl]methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 143614084 |
| Molecular Formula | C24H22N3O2PS |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | N-(2-amino-5-thiophen-3-ylphenyl)-6-[[methoxy(phenyl)phosphanyl]methyl]pyridine-3-carboxamide |
| SMILES | COP(Cc1ccc(C(=O)Nc2cc(-c3ccsc3)ccc2N)cn1)c1ccccc1 |
| InChI | InChI=1S/C24H22N3O2PS/c1-29-30(21-5-3-2-4-6-21)15-20-9-7-18(14-26-20)24(28)27-23-13-17(8-10-22(23)25)19-11-12-31-16-19/h2-14,16H,15,25H2,1H3,(H,27,28) |
| InChIKey | JLMDZOZSOMFDMN-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|