C24H24N4O4S — CID 67497881
[(2S)-3-[4-[(2-amino-5-thiophen-3-ylphenyl)carbamoyl]phenyl]-1-(cyclopropylamino)-1-oxopropan-2-yl]carbamic acid (PubChem CID 67497881) has the molecular formula C24H24N4O4S and a molecular weight of 464.55 g/mol. Its IUPAC name is [(2S)-3-[4-[(2-amino-5-thiophen-3-ylphenyl)carbamoyl]phenyl]-1-(cyclopropylamino)-1-oxopropan-2-yl]carbamic acid.
| Compound Name | [(2S)-3-[4-[(2-amino-5-thiophen-3-ylphenyl)carbamoyl]phenyl]-1-(cyclopropylamino)-1-oxopropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 67497881 |
| Molecular Formula | C24H24N4O4S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | [(2S)-3-[4-[(2-amino-5-thiophen-3-ylphenyl)carbamoyl]phenyl]-1-(cyclopropylamino)-1-oxopropan-2-yl]carbamic acid |
| SMILES | Nc1ccc(-c2ccsc2)cc1NC(=O)c1ccc(C[C@H](NC(=O)O)C(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C24H24N4O4S/c25-19-8-5-16(17-9-10-33-13-17)12-20(19)27-22(29)15-3-1-14(2-4-15)11-21(28-24(31)32)23(30)26-18-6-7-18/h1-5,8-10,12-13,18,21,28H,6-7,11,25H2,(H,26,30)(H,27,29)(H,31,32)/t21-/m0/s1 |
| InChIKey | KTERTRKTICZQGS-NRFANRHFSA-N |
| XLogP | 3.71 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|