C14H14N2OS — CID 126538925
3-amino-N-cyclopropyl-4-thiophen-3-ylbenzamide (PubChem CID 126538925) has the molecular formula C14H14N2OS and a molecular weight of 258.35 g/mol. Its IUPAC name is 3-amino-N-cyclopropyl-4-thiophen-3-ylbenzamide.
| Compound Name | 3-amino-N-cyclopropyl-4-thiophen-3-ylbenzamide |
|---|---|
| PubChem CID | 126538925 |
| Molecular Formula | C14H14N2OS |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 3-amino-N-cyclopropyl-4-thiophen-3-ylbenzamide |
| SMILES | Nc1cc(C(=O)NC2CC2)ccc1-c1ccsc1 |
| InChI | InChI=1S/C14H14N2OS/c15-13-7-9(14(17)16-11-2-3-11)1-4-12(13)10-5-6-18-8-10/h1,4-8,11H,2-3,15H2,(H,16,17) |
| InChIKey | ASWVHVQFBRABFE-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|