C25H29NO3 — CID 59739466
3-[2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethoxy]propane-1,2-diol (PubChem CID 59739466) has the molecular formula C25H29NO3 and a molecular weight of 391.51 g/mol. Its IUPAC name is 3-[2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethoxy]propane-1,2-diol.
| Compound Name | 3-[2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 59739466 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 3-[2-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]ethoxy]propane-1,2-diol |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(CCOCC(O)CO)cc2)cc1 |
| InChI | InChI=1S/C25H29NO3/c1-19-3-9-22(10-4-19)26(23-11-5-20(2)6-12-23)24-13-7-21(8-14-24)15-16-29-18-25(28)17-27/h3-14,25,27-28H,15-18H2,1-2H3 |
| InChIKey | DYWMMJLJJSFNIW-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|