C38H44O6 — CID 59742568
1,8-bis[(E)-2-(4-butan-2-yloxy-3,5-dimethoxyphenyl)ethenyl]naphthalene (PubChem CID 59742568) has the molecular formula C38H44O6 and a molecular weight of 596.76 g/mol. Its IUPAC name is 1,8-bis[(E)-2-(4-butan-2-yloxy-3,5-dimethoxyphenyl)ethenyl]naphthalene.
| Compound Name | 1,8-bis[(E)-2-(4-butan-2-yloxy-3,5-dimethoxyphenyl)ethenyl]naphthalene |
|---|---|
| PubChem CID | 59742568 |
| Molecular Formula | C38H44O6 |
| Molecular Weight | 596.76 g/mol |
| Exact Mass | 596.31 |
| IUPAC Name | 1,8-bis[(E)-2-(4-butan-2-yloxy-3,5-dimethoxyphenyl)ethenyl]naphthalene |
| SMILES | CCC(C)Oc1c(OC)cc(/C=C/c2cccc3cccc(/C=C/c4cc(OC)c(OC(C)CC)c(OC)c4)c23)cc1OC |
| InChI | InChI=1S/C38H44O6/c1-9-25(3)43-37-32(39-5)21-27(22-33(37)40-6)17-19-30-15-11-13-29-14-12-16-31(36(29)30)20-18-28-23-34(41-7)38(35(24-28)42-8)44-26(4)10-2/h11-26H,9-10H2,1-8H3/b19-17+,20-18+ |
| InChIKey | CQBBSHNMLXQIKJ-XPWSMXQVSA-N |
| XLogP | 9.57 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.76 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|