C21H25N5O4 — CID 59742882
N-[3-(3-methoxypropyl)-6-(piperidine-1-carbonyl)imidazo[4,5-b]pyridin-2-yl]furan-2-carboxamide (PubChem CID 59742882) has the molecular formula C21H25N5O4 and a molecular weight of 411.46 g/mol. Its IUPAC name is N-[3-(3-methoxypropyl)-6-(piperidine-1-carbonyl)imidazo[4,5-b]pyridin-2-yl]furan-2-carboxamide.
| Compound Name | N-[3-(3-methoxypropyl)-6-(piperidine-1-carbonyl)imidazo[4,5-b]pyridin-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 59742882 |
| Molecular Formula | C21H25N5O4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | N-[3-(3-methoxypropyl)-6-(piperidine-1-carbonyl)imidazo[4,5-b]pyridin-2-yl]furan-2-carboxamide |
| SMILES | COCCCn1c(NC(=O)c2ccco2)nc2cc(C(=O)N3CCCCC3)cnc21 |
| InChI | InChI=1S/C21H25N5O4/c1-29-11-6-10-26-18-16(23-21(26)24-19(27)17-7-5-12-30-17)13-15(14-22-18)20(28)25-8-3-2-4-9-25/h5,7,12-14H,2-4,6,8-11H2,1H3,(H,23,24,27) |
| InChIKey | LJKVSCHUGXJYCB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|