C10H12Cl2 — CID 597443
3,5-dichlorotricyclo[5.2.1.04,8]dec-2-ene (PubChem CID 597443) has the molecular formula C10H12Cl2 and a molecular weight of 203.11 g/mol. Its IUPAC name is 3,5-dichlorotricyclo[5.2.1.04,8]dec-2-ene.
| Compound Name | 3,5-dichlorotricyclo[5.2.1.04,8]dec-2-ene |
|---|---|
| PubChem CID | 597443 |
| Molecular Formula | C10H12Cl2 |
| Molecular Weight | 203.11 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | 3,5-dichlorotricyclo[5.2.1.04,8]dec-2-ene |
| SMILES | ClC1=CC2CC3CC(Cl)C1C3C2 |
| InChI | InChI=1S/C10H12Cl2/c11-8-3-5-1-6-4-9(12)10(8)7(6)2-5/h3,5-7,9-10H,1-2,4H2 |
| InChIKey | YEVBMZZACQRDHM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.11 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|