C31H34N2O3S — CID 59746311
N-[[(2R)-1-benzylsulfanyl-3-oxobutan-2-yl]carbamoyl]-N-cyclohexyl-3-phenylbenzamide (PubChem CID 59746311) has the molecular formula C31H34N2O3S and a molecular weight of 514.69 g/mol. Its IUPAC name is N-[[(2R)-1-benzylsulfanyl-3-oxobutan-2-yl]carbamoyl]-N-cyclohexyl-3-phenylbenzamide.
| Compound Name | N-[[(2R)-1-benzylsulfanyl-3-oxobutan-2-yl]carbamoyl]-N-cyclohexyl-3-phenylbenzamide |
|---|---|
| PubChem CID | 59746311 |
| Molecular Formula | C31H34N2O3S |
| Molecular Weight | 514.69 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | N-[[(2R)-1-benzylsulfanyl-3-oxobutan-2-yl]carbamoyl]-N-cyclohexyl-3-phenylbenzamide |
| SMILES | CC(=O)[C@H](CSCc1ccccc1)NC(=O)N(C(=O)c1cccc(-c2ccccc2)c1)C1CCCCC1 |
| InChI | InChI=1S/C31H34N2O3S/c1-23(34)29(22-37-21-24-12-5-2-6-13-24)32-31(36)33(28-18-9-4-10-19-28)30(35)27-17-11-16-26(20-27)25-14-7-3-8-15-25/h2-3,5-8,11-17,20,28-29H,4,9-10,18-19,21-22H2,1H3,(H,32,36)/t29-/m0/s1 |
| InChIKey | IUAFKVARKCHXCJ-LJAQVGFWSA-N |
| XLogP | 6.73 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.69 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |