C21H21N3O3S — CID 90719522
3-acetyl-N-[(2R)-3-benzylsulfanyl-1-[cyano(methyl)amino]-1-oxopropan-2-yl]benzamide (PubChem CID 90719522) has the molecular formula C21H21N3O3S and a molecular weight of 395.48 g/mol. Its IUPAC name is 3-acetyl-N-[(2R)-3-benzylsulfanyl-1-[cyano(methyl)amino]-1-oxopropan-2-yl]benzamide.
| Compound Name | 3-acetyl-N-[(2R)-3-benzylsulfanyl-1-[cyano(methyl)amino]-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 90719522 |
| Molecular Formula | C21H21N3O3S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 3-acetyl-N-[(2R)-3-benzylsulfanyl-1-[cyano(methyl)amino]-1-oxopropan-2-yl]benzamide |
| SMILES | CC(=O)c1cccc(C(=O)N[C@@H](CSCc2ccccc2)C(=O)N(C)C#N)c1 |
| InChI | InChI=1S/C21H21N3O3S/c1-15(25)17-9-6-10-18(11-17)20(26)23-19(21(27)24(2)14-22)13-28-12-16-7-4-3-5-8-16/h3-11,19H,12-13H2,1-2H3,(H,23,26)/t19-/m0/s1 |
| InChIKey | GXZCHGXGWCDUID-IBGZPJMESA-N |
| XLogP | 2.86 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|