C17H17N3O2S2 — CID 91428295
N-[(2R)-3-benzylsulfanyl-1-[cyano(methyl)amino]-1-oxopropan-2-yl]thiophene-3-carboxamide (PubChem CID 91428295) has the molecular formula C17H17N3O2S2 and a molecular weight of 359.48 g/mol. Its IUPAC name is N-[(2R)-3-benzylsulfanyl-1-[cyano(methyl)amino]-1-oxopropan-2-yl]thiophene-3-carboxamide.
| Compound Name | N-[(2R)-3-benzylsulfanyl-1-[cyano(methyl)amino]-1-oxopropan-2-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 91428295 |
| Molecular Formula | C17H17N3O2S2 |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | N-[(2R)-3-benzylsulfanyl-1-[cyano(methyl)amino]-1-oxopropan-2-yl]thiophene-3-carboxamide |
| SMILES | CN(C#N)C(=O)[C@H](CSCc1ccccc1)NC(=O)c1ccsc1 |
| InChI | InChI=1S/C17H17N3O2S2/c1-20(12-18)17(22)15(19-16(21)14-7-8-23-10-14)11-24-9-13-5-3-2-4-6-13/h2-8,10,15H,9,11H2,1H3,(H,19,21)/t15-/m0/s1 |
| InChIKey | BSDDRMMZFHXFNS-HNNXBMFYSA-N |
| XLogP | 2.72 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|