C20H25N3O2 — CID 87850233
N-[(2S)-1-[cyano(methyl)amino]-3-(4-ethylidenecyclohexyl)-1-oxopropan-2-yl]benzamide (PubChem CID 87850233) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-[(2S)-1-[cyano(methyl)amino]-3-(4-ethylidenecyclohexyl)-1-oxopropan-2-yl]benzamide.
| Compound Name | N-[(2S)-1-[cyano(methyl)amino]-3-(4-ethylidenecyclohexyl)-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 87850233 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | N-[(2S)-1-[cyano(methyl)amino]-3-(4-ethylidenecyclohexyl)-1-oxopropan-2-yl]benzamide |
| SMILES | CC=C1CCC(C[C@H](NC(=O)c2ccccc2)C(=O)N(C)C#N)CC1 |
| InChI | InChI=1S/C20H25N3O2/c1-3-15-9-11-16(12-10-15)13-18(20(25)23(2)14-21)22-19(24)17-7-5-4-6-8-17/h3-8,16,18H,9-13H2,1-2H3,(H,22,24)/b15-3-/t16?,18-/m0/s1 |
| InChIKey | NWSVYXGUKODPBB-BCRXUMASSA-N |
| XLogP | 3.25 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|