C12H18ClN3O5S2 — CID 59748918
6-chloro-3-(5-hydroxypentyl)-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide (PubChem CID 59748918) has the molecular formula C12H18ClN3O5S2 and a molecular weight of 383.88 g/mol. Its IUPAC name is 6-chloro-3-(5-hydroxypentyl)-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide.
| Compound Name | 6-chloro-3-(5-hydroxypentyl)-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide |
|---|---|
| PubChem CID | 59748918 |
| Molecular Formula | C12H18ClN3O5S2 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | 6-chloro-3-(5-hydroxypentyl)-1,1-dioxo-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide |
| SMILES | NS(=O)(=O)c1cc2c(cc1Cl)NC(CCCCCO)NS2(=O)=O |
| InChI | InChI=1S/C12H18ClN3O5S2/c13-8-6-9-11(7-10(8)22(14,18)19)23(20,21)16-12(15-9)4-2-1-3-5-17/h6-7,12,15-17H,1-5H2,(H2,14,18,19) |
| InChIKey | OQFZKTHHWAQZCU-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|