C12H18ClN3O4S2 — CID 101195556
6-chloro-1,1-dioxo-3-pentyl-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide (PubChem CID 101195556) has the molecular formula C12H18ClN3O4S2 and a molecular weight of 367.88 g/mol. Its IUPAC name is 6-chloro-1,1-dioxo-3-pentyl-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide.
| Compound Name | 6-chloro-1,1-dioxo-3-pentyl-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide |
|---|---|
| PubChem CID | 101195556 |
| Molecular Formula | C12H18ClN3O4S2 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | 6-chloro-1,1-dioxo-3-pentyl-3,4-dihydro-2H-1λ6,2,4-benzothiadiazine-7-sulfonamide |
| SMILES | CCCCCC1Nc2cc(Cl)c(S(N)(=O)=O)cc2S(=O)(=O)N1 |
| InChI | InChI=1S/C12H18ClN3O4S2/c1-2-3-4-5-12-15-9-6-8(13)10(21(14,17)18)7-11(9)22(19,20)16-12/h6-7,12,15-16H,2-5H2,1H3,(H2,14,17,18) |
| InChIKey | MEWDBOWYCKQYPM-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|