C10H14N2O — CID 59751925
4-ethyl-5,6,7,8-tetrahydro-2H-phthalazin-1-one (PubChem CID 59751925) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 4-ethyl-5,6,7,8-tetrahydro-2H-phthalazin-1-one.
| Compound Name | 4-ethyl-5,6,7,8-tetrahydro-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 59751925 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 4-ethyl-5,6,7,8-tetrahydro-2H-phthalazin-1-one |
| SMILES | CCc1n[nH]c(=O)c2c1CCCC2 |
| InChI | InChI=1S/C10H14N2O/c1-2-9-7-5-3-4-6-8(7)10(13)12-11-9/h2-6H2,1H3,(H,12,13) |
| InChIKey | CJERIUFLURATFA-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |