C17H23FN2O5 — CID 59754129
(5R)-3-[4-(3-fluoro-4,4-dimethoxypiperidin-1-yl)phenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one (PubChem CID 59754129) has the molecular formula C17H23FN2O5 and a molecular weight of 354.38 g/mol. Its IUPAC name is (5R)-3-[4-(3-fluoro-4,4-dimethoxypiperidin-1-yl)phenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one.
| Compound Name | (5R)-3-[4-(3-fluoro-4,4-dimethoxypiperidin-1-yl)phenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 59754129 |
| Molecular Formula | C17H23FN2O5 |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | (5R)-3-[4-(3-fluoro-4,4-dimethoxypiperidin-1-yl)phenyl]-5-(hydroxymethyl)-1,3-oxazolidin-2-one |
| SMILES | COC1(OC)CCN(c2ccc(N3C[C@H](CO)OC3=O)cc2)CC1F |
| InChI | InChI=1S/C17H23FN2O5/c1-23-17(24-2)7-8-19(10-15(17)18)12-3-5-13(6-4-12)20-9-14(11-21)25-16(20)22/h3-6,14-15,21H,7-11H2,1-2H3/t14-,15?/m1/s1 |
| InChIKey | ISHMCSLLNXISOX-GICMACPYSA-N |
| XLogP | 1.54 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|