C18H23F2N2O7S- — CID 86591701
2-[(5R)-3-[4-(3,3-difluoro-4,4-dimethoxypiperidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]ethanesulfonate (PubChem CID 86591701) has the molecular formula C18H23F2N2O7S- and a molecular weight of 449.45 g/mol. Its IUPAC name is 2-[(5R)-3-[4-(3,3-difluoro-4,4-dimethoxypiperidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]ethanesulfonate.
| Compound Name | 2-[(5R)-3-[4-(3,3-difluoro-4,4-dimethoxypiperidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]ethanesulfonate |
|---|---|
| PubChem CID | 86591701 |
| Molecular Formula | C18H23F2N2O7S- |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 2-[(5R)-3-[4-(3,3-difluoro-4,4-dimethoxypiperidin-1-yl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]ethanesulfonate |
| SMILES | COC1(OC)CCN(c2ccc(N3C[C@@H](CCS(=O)(=O)[O-])OC3=O)cc2)CC1(F)F |
| InChI | InChI=1S/C18H24F2N2O7S/c1-27-18(28-2)8-9-21(12-17(18,19)20)13-3-5-14(6-4-13)22-11-15(29-16(22)23)7-10-30(24,25)26/h3-6,15H,7-12H2,1-2H3,(H,24,25,26)/p-1/t15-/m1/s1 |
| InChIKey | OVRZXWPGKMPREB-OAHLLOKOSA-M |
| XLogP | 1.78 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|