C18H25N3O4 — CID 162208673
(5S)-3-[4-(2-methyl-1,2,5-oxadiazepan-5-yl)phenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one (PubChem CID 162208673) has the molecular formula C18H25N3O4 and a molecular weight of 347.41 g/mol. Its IUPAC name is (5S)-3-[4-(2-methyl-1,2,5-oxadiazepan-5-yl)phenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one.
| Compound Name | (5S)-3-[4-(2-methyl-1,2,5-oxadiazepan-5-yl)phenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 162208673 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | (5S)-3-[4-(2-methyl-1,2,5-oxadiazepan-5-yl)phenyl]-5-(3-oxobutyl)-1,3-oxazolidin-2-one |
| SMILES | CC(=O)CC[C@H]1CN(c2ccc(N3CCON(C)CC3)cc2)C(=O)O1 |
| InChI | InChI=1S/C18H25N3O4/c1-14(22)3-8-17-13-21(18(23)25-17)16-6-4-15(5-7-16)20-10-9-19(2)24-12-11-20/h4-7,17H,3,8-13H2,1-2H3/t17-/m0/s1 |
| InChIKey | ZSNUQDYNIJCAMN-KRWDZBQOSA-N |
| XLogP | 2.06 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|