C17H23F2N3O4 — CID 69311940
5-(aminomethyl)-3-[3-fluoro-4-[(3S)-3-fluoro-4,4-dimethoxypiperidin-1-yl]phenyl]-1,3-oxazolidin-2-one (PubChem CID 69311940) has the molecular formula C17H23F2N3O4 and a molecular weight of 371.38 g/mol. Its IUPAC name is 5-(aminomethyl)-3-[3-fluoro-4-[(3S)-3-fluoro-4,4-dimethoxypiperidin-1-yl]phenyl]-1,3-oxazolidin-2-one.
| Compound Name | 5-(aminomethyl)-3-[3-fluoro-4-[(3S)-3-fluoro-4,4-dimethoxypiperidin-1-yl]phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 69311940 |
| Molecular Formula | C17H23F2N3O4 |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 5-(aminomethyl)-3-[3-fluoro-4-[(3S)-3-fluoro-4,4-dimethoxypiperidin-1-yl]phenyl]-1,3-oxazolidin-2-one |
| SMILES | COC1(OC)CCN(c2ccc(N3CC(CN)OC3=O)cc2F)C[C@@H]1F |
| InChI | InChI=1S/C17H23F2N3O4/c1-24-17(25-2)5-6-21(10-15(17)19)14-4-3-11(7-13(14)18)22-9-12(8-20)26-16(22)23/h3-4,7,12,15H,5-6,8-10,20H2,1-2H3/t12?,15-/m0/s1 |
| InChIKey | DNXUKFNXRKOQDA-CVRLYYSRSA-N |
| XLogP | 1.65 |
| TPSA | 77.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|