C30H27N3O4 — CID 59754537
5-[5-(2-methoxy-4-nitrophenyl)-1H-pyrrol-2-yl]-2,2-dimethyl-1,3,5,6-tetrahydrobenzo[a]phenanthridin-4-one (PubChem CID 59754537) has the molecular formula C30H27N3O4 and a molecular weight of 493.56 g/mol. Its IUPAC name is 5-[5-(2-methoxy-4-nitrophenyl)-1H-pyrrol-2-yl]-2,2-dimethyl-1,3,5,6-tetrahydrobenzo[a]phenanthridin-4-one.
| Compound Name | 5-[5-(2-methoxy-4-nitrophenyl)-1H-pyrrol-2-yl]-2,2-dimethyl-1,3,5,6-tetrahydrobenzo[a]phenanthridin-4-one |
|---|---|
| PubChem CID | 59754537 |
| Molecular Formula | C30H27N3O4 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 5-[5-(2-methoxy-4-nitrophenyl)-1H-pyrrol-2-yl]-2,2-dimethyl-1,3,5,6-tetrahydrobenzo[a]phenanthridin-4-one |
| SMILES | COc1cc([N+](=O)[O-])ccc1-c1ccc(C2Nc3ccc4ccccc4c3C3=C2C(=O)CC(C)(C)C3)[nH]1 |
| InChI | InChI=1S/C30H27N3O4/c1-30(2)15-21-27-19-7-5-4-6-17(19)8-11-23(27)32-29(28(21)25(34)16-30)24-13-12-22(31-24)20-10-9-18(33(35)36)14-26(20)37-3/h4-14,29,31-32H,15-16H2,1-3H3 |
| InChIKey | AWVKZWRQGIVKPI-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 97.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|