C28H37N5O7 — CID 59754646
2-[[2-[(4-methoxyphenyl)iminocarbamoylamino]-3-phenylpropanoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (PubChem CID 59754646) has the molecular formula C28H37N5O7 and a molecular weight of 555.63 g/mol. Its IUPAC name is 2-[[2-[(4-methoxyphenyl)iminocarbamoylamino]-3-phenylpropanoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | 2-[[2-[(4-methoxyphenyl)iminocarbamoylamino]-3-phenylpropanoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 59754646 |
| Molecular Formula | C28H37N5O7 |
| Molecular Weight | 555.63 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | 2-[[2-[(4-methoxyphenyl)iminocarbamoylamino]-3-phenylpropanoyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| SMILES | COc1ccc(/N=N/C(=O)NC(Cc2ccccc2)C(=O)NC(CCCCNC(=O)OC(C)(C)C)C(=O)O)cc1 |
| InChI | InChI=1S/C28H37N5O7/c1-28(2,3)40-27(38)29-17-9-8-12-22(25(35)36)30-24(34)23(18-19-10-6-5-7-11-19)31-26(37)33-32-20-13-15-21(39-4)16-14-20/h5-7,10-11,13-16,22-23H,8-9,12,17-18H2,1-4H3,(H,29,38)(H,30,34)(H,31,37)(H,35,36)/b33-32+ |
| InChIKey | INWWBXBFJYIXJR-ULIFNZDWSA-N |
| XLogP | 4.36 |
| TPSA | 167.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.63 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|