C23H29N7O5 — CID 69203193
(2S)-5-(diaminomethylideneamino)-2-[[(2S)-3-(4-methoxyphenyl)-2-(phenyliminocarbamoylamino)propanoyl]amino]pentanoic acid (PubChem CID 69203193) has the molecular formula C23H29N7O5 and a molecular weight of 483.53 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[(2S)-3-(4-methoxyphenyl)-2-(phenyliminocarbamoylamino)propanoyl]amino]pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[(2S)-3-(4-methoxyphenyl)-2-(phenyliminocarbamoylamino)propanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 69203193 |
| Molecular Formula | C23H29N7O5 |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[(2S)-3-(4-methoxyphenyl)-2-(phenyliminocarbamoylamino)propanoyl]amino]pentanoic acid |
| SMILES | COc1ccc(C[C@H](NC(=O)/N=N/c2ccccc2)C(=O)N[C@@H](CCCN=C(N)N)C(=O)O)cc1 |
| InChI | InChI=1S/C23H29N7O5/c1-35-17-11-9-15(10-12-17)14-19(28-23(34)30-29-16-6-3-2-4-7-16)20(31)27-18(21(32)33)8-5-13-26-22(24)25/h2-4,6-7,9-12,18-19H,5,8,13-14H2,1H3,(H,27,31)(H,28,34)(H,32,33)(H4,24,25,26)/b30-29+/t18-,19-/m0/s1 |
| InChIKey | GSBXDQBLOMMVQR-UNIQPNKISA-N |
| XLogP | 1.72 |
| TPSA | 193.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|