C24H30ClN7O4 — CID 59754638
2-[[2-[(3-chloro-4-methylphenyl)iminocarbamoylamino]-3-phenylpropanoyl]amino]-6-(diaminomethylideneamino)hexanoic acid (PubChem CID 59754638) has the molecular formula C24H30ClN7O4 and a molecular weight of 516.00 g/mol. Its IUPAC name is 2-[[2-[(3-chloro-4-methylphenyl)iminocarbamoylamino]-3-phenylpropanoyl]amino]-6-(diaminomethylideneamino)hexanoic acid.
| Compound Name | 2-[[2-[(3-chloro-4-methylphenyl)iminocarbamoylamino]-3-phenylpropanoyl]amino]-6-(diaminomethylideneamino)hexanoic acid |
|---|---|
| PubChem CID | 59754638 |
| Molecular Formula | C24H30ClN7O4 |
| Molecular Weight | 516.00 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | 2-[[2-[(3-chloro-4-methylphenyl)iminocarbamoylamino]-3-phenylpropanoyl]amino]-6-(diaminomethylideneamino)hexanoic acid |
| SMILES | Cc1ccc(/N=N/C(=O)NC(Cc2ccccc2)C(=O)NC(CCCCN=C(N)N)C(=O)O)cc1Cl |
| InChI | InChI=1S/C24H30ClN7O4/c1-15-10-11-17(14-18(15)25)31-32-24(36)30-20(13-16-7-3-2-4-8-16)21(33)29-19(22(34)35)9-5-6-12-28-23(26)27/h2-4,7-8,10-11,14,19-20H,5-6,9,12-13H2,1H3,(H,29,33)(H,30,36)(H,34,35)(H4,26,27,28)/b32-31+ |
| InChIKey | FQVPKEDEGRQCJU-QNEJGDQOSA-N |
| XLogP | 3.07 |
| TPSA | 184.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.00 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|