C24H33N7O4 — CID 59754657
5-(diaminomethylamino)-2-[[2-[(2,5-dimethylphenyl)iminocarbamoylamino]-3-phenylpropanoyl]amino]pentanoic acid (PubChem CID 59754657) has the molecular formula C24H33N7O4 and a molecular weight of 483.57 g/mol. Its IUPAC name is 5-(diaminomethylamino)-2-[[2-[(2,5-dimethylphenyl)iminocarbamoylamino]-3-phenylpropanoyl]amino]pentanoic acid.
| Compound Name | 5-(diaminomethylamino)-2-[[2-[(2,5-dimethylphenyl)iminocarbamoylamino]-3-phenylpropanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 59754657 |
| Molecular Formula | C24H33N7O4 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.26 |
| IUPAC Name | 5-(diaminomethylamino)-2-[[2-[(2,5-dimethylphenyl)iminocarbamoylamino]-3-phenylpropanoyl]amino]pentanoic acid |
| SMILES | Cc1ccc(C)c(/N=N/C(=O)NC(Cc2ccccc2)C(=O)NC(CCCNC(N)N)C(=O)O)c1 |
| InChI | InChI=1S/C24H33N7O4/c1-15-10-11-16(2)19(13-15)30-31-24(35)29-20(14-17-7-4-3-5-8-17)21(32)28-18(22(33)34)9-6-12-27-23(25)26/h3-5,7-8,10-11,13,18,20,23,27H,6,9,12,14,25-26H2,1-2H3,(H,28,32)(H,29,35)(H,33,34)/b31-30+ |
| InChIKey | KRQGLSFYRFZOAE-NVQSTNCTSA-N |
| XLogP | 1.85 |
| TPSA | 184.29 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|