C23H28ClN7O4 — CID 10164054
2-[[2-[(3-chloro-4-methylphenyl)iminocarbamoylamino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 10164054) has the molecular formula C23H28ClN7O4 and a molecular weight of 501.98 g/mol. Its IUPAC name is 2-[[2-[(3-chloro-4-methylphenyl)iminocarbamoylamino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | 2-[[2-[(3-chloro-4-methylphenyl)iminocarbamoylamino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 10164054 |
| Molecular Formula | C23H28ClN7O4 |
| Molecular Weight | 501.98 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | 2-[[2-[(3-chloro-4-methylphenyl)iminocarbamoylamino]-3-phenylpropanoyl]amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | Cc1ccc(/N=N/C(=O)NC(Cc2ccccc2)C(=O)NC(CCCN=C(N)N)C(=O)O)cc1Cl |
| InChI | InChI=1S/C23H28ClN7O4/c1-14-9-10-16(13-17(14)24)30-31-23(35)29-19(12-15-6-3-2-4-7-15)20(32)28-18(21(33)34)8-5-11-27-22(25)26/h2-4,6-7,9-10,13,18-19H,5,8,11-12H2,1H3,(H,28,32)(H,29,35)(H,33,34)(H4,25,26,27)/b31-30+ |
| InChIKey | SBYYUEKFYCLANX-NVQSTNCTSA-N |
| XLogP | 2.68 |
| TPSA | 184.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.98 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|