C20H18ClN3O3S — CID 59755067
4-chloro-11-(3,4-dimethoxyphenyl)-6-ethoxy-13-methyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 59755067) has the molecular formula C20H18ClN3O3S and a molecular weight of 415.90 g/mol. Its IUPAC name is 4-chloro-11-(3,4-dimethoxyphenyl)-6-ethoxy-13-methyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 4-chloro-11-(3,4-dimethoxyphenyl)-6-ethoxy-13-methyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 59755067 |
| Molecular Formula | C20H18ClN3O3S |
| Molecular Weight | 415.90 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | 4-chloro-11-(3,4-dimethoxyphenyl)-6-ethoxy-13-methyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | CCOc1nc(Cl)nc2c1sc1nc(-c3ccc(OC)c(OC)c3)cc(C)c12 |
| InChI | InChI=1S/C20H18ClN3O3S/c1-5-27-18-17-16(23-20(21)24-18)15-10(2)8-12(22-19(15)28-17)11-6-7-13(25-3)14(9-11)26-4/h6-9H,5H2,1-4H3 |
| InChIKey | WQHNAEJDUYOOOC-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.90 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |