C13H11F6N2+ — CID 59757557
1-methyl-2-[1-methyl-3,5-bis(trifluoromethyl)pyrrol-2-yl]pyridin-1-ium (PubChem CID 59757557) has the molecular formula C13H11F6N2+ and a molecular weight of 309.23 g/mol. Its IUPAC name is 1-methyl-2-[1-methyl-3,5-bis(trifluoromethyl)pyrrol-2-yl]pyridin-1-ium.
| Compound Name | 1-methyl-2-[1-methyl-3,5-bis(trifluoromethyl)pyrrol-2-yl]pyridin-1-ium |
|---|---|
| PubChem CID | 59757557 |
| Molecular Formula | C13H11F6N2+ |
| Molecular Weight | 309.23 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 1-methyl-2-[1-methyl-3,5-bis(trifluoromethyl)pyrrol-2-yl]pyridin-1-ium |
| SMILES | Cn1c(C(F)(F)F)cc(C(F)(F)F)c1-c1cccc[n+]1C |
| InChI | InChI=1S/C13H11F6N2/c1-20-6-4-3-5-9(20)11-8(12(14,15)16)7-10(21(11)2)13(17,18)19/h3-7H,1-2H3/q+1 |
| InChIKey | NSNJAAHYTKXJTI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.23 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|