C24H36 — CID 59760991
(3S,9S,10R,13R,14R,17R)-3,10,13-trimethyl-17-(1-methylcyclopropyl)-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 59760991) has the molecular formula C24H36 and a molecular weight of 324.55 g/mol. Its IUPAC name is (3S,9S,10R,13R,14R,17R)-3,10,13-trimethyl-17-(1-methylcyclopropyl)-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (3S,9S,10R,13R,14R,17R)-3,10,13-trimethyl-17-(1-methylcyclopropyl)-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 59760991 |
| Molecular Formula | C24H36 |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 324.28 |
| IUPAC Name | (3S,9S,10R,13R,14R,17R)-3,10,13-trimethyl-17-(1-methylcyclopropyl)-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C[C@H]1CC[C@@]2(C)C(=CC=C3[C@@H]4CC[C@H](C5(C)CC5)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C24H36/c1-16-9-11-23(3)17(15-16)5-6-18-19-7-8-21(22(2)13-14-22)24(19,4)12-10-20(18)23/h5-6,16,19-21H,7-15H2,1-4H3/t16-,19-,20-,21+,23-,24-/m0/s1 |
| InChIKey | DWRZWABNLADZSO-QCILMINVSA-N |
| XLogP | 6.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |