C25H42O3 — CID 59761075
(6R)-6-[(1R,3aS,4S,5S,7aR)-1-[(2S)-butan-2-yl]-4-(2,2-dimethoxyethyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-6-methylcyclohex-2-en-1-one (PubChem CID 59761075) has the molecular formula C25H42O3 and a molecular weight of 390.61 g/mol. Its IUPAC name is (6R)-6-[(1R,3aS,4S,5S,7aR)-1-[(2S)-butan-2-yl]-4-(2,2-dimethoxyethyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-6-methylcyclohex-2-en-1-one.
| Compound Name | (6R)-6-[(1R,3aS,4S,5S,7aR)-1-[(2S)-butan-2-yl]-4-(2,2-dimethoxyethyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-6-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 59761075 |
| Molecular Formula | C25H42O3 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | (6R)-6-[(1R,3aS,4S,5S,7aR)-1-[(2S)-butan-2-yl]-4-(2,2-dimethoxyethyl)-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-5-yl]-6-methylcyclohex-2-en-1-one |
| SMILES | CC[C@H](C)[C@H]1CC[C@H]2[C@H](CC(OC)OC)[C@@H]([C@@]3(C)CCC=CC3=O)CC[C@]12C |
| InChI | InChI=1S/C25H42O3/c1-7-17(2)19-11-12-20-18(16-23(27-5)28-6)21(13-15-24(19,20)3)25(4)14-9-8-10-22(25)26/h8,10,17-21,23H,7,9,11-16H2,1-6H3/t17-,18-,19+,20-,21-,24+,25+/m0/s1 |
| InChIKey | OEJHDDIGIOLPBB-QTLKIFITSA-N |
| XLogP | 6.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|