C18H34GdN10O4 — CID 59766032
2-[7-(2-amino-2-oxoethyl)-4-[2-(azidomethylamino)-2-oxoethyl]-10-(2-oxopropyl)-1,4,7,10-tetrazacyclododec-1-yl]acetamide;gadolinium (PubChem CID 59766032) has the molecular formula C18H34GdN10O4 and a molecular weight of 611.79 g/mol. Its IUPAC name is 2-[7-(2-amino-2-oxoethyl)-4-[2-(azidomethylamino)-2-oxoethyl]-10-(2-oxopropyl)-1,4,7,10-tetrazacyclododec-1-yl]acetamide;gadolinium.
| Compound Name | 2-[7-(2-amino-2-oxoethyl)-4-[2-(azidomethylamino)-2-oxoethyl]-10-(2-oxopropyl)-1,4,7,10-tetrazacyclododec-1-yl]acetamide;gadolinium |
|---|---|
| PubChem CID | 59766032 |
| Molecular Formula | C18H34GdN10O4 |
| Molecular Weight | 611.79 g/mol |
| Exact Mass | 612.20 |
| IUPAC Name | 2-[7-(2-amino-2-oxoethyl)-4-[2-(azidomethylamino)-2-oxoethyl]-10-(2-oxopropyl)-1,4,7,10-tetrazacyclododec-1-yl]acetamide;gadolinium |
| SMILES | CC(=O)CN1CCN(CC(N)=O)CCN(CC(=O)NCN=[N+]=[N-])CCN(CC(N)=O)CC1.[Gd] |
| InChI | InChI=1S/C18H34N10O4.Gd/c1-15(29)10-25-2-4-26(11-16(19)30)6-8-28(13-18(32)22-14-23-24-21)9-7-27(5-3-25)12-17(20)31;/h2-14H2,1H3,(H2,19,30)(H2,20,31)(H,22,32); |
| InChIKey | WDZZGJQHNVPCHI-UHFFFAOYSA-N |
| XLogP | -2.85 |
| TPSA | 194.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.79 |
| LogP ≤ 5 | -2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|