C19H23NO5S — CID 59771417
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[2-(4-methylanilino)phenoxy]thiane-3,4,5-triol (PubChem CID 59771417) has the molecular formula C19H23NO5S and a molecular weight of 377.46 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[2-(4-methylanilino)phenoxy]thiane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[2-(4-methylanilino)phenoxy]thiane-3,4,5-triol |
|---|---|
| PubChem CID | 59771417 |
| Molecular Formula | C19H23NO5S |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[2-(4-methylanilino)phenoxy]thiane-3,4,5-triol |
| SMILES | Cc1ccc(Nc2ccccc2O[C@@H]2S[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C19H23NO5S/c1-11-6-8-12(9-7-11)20-13-4-2-3-5-14(13)25-19-18(24)17(23)16(22)15(10-21)26-19/h2-9,15-24H,10H2,1H3/t15-,16-,17+,18-,19-/m1/s1 |
| InChIKey | PPHZZLSJRXJJMJ-UJWQCDCRSA-N |
| XLogP | 1.63 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |