C23H29ClO5S — CID 59771406
(2R,3R,4S,5S,6R)-2-[2-[(4-tert-butylphenyl)methyl]-4-chlorophenoxy]-6-(hydroxymethyl)thiane-3,4,5-triol (PubChem CID 59771406) has the molecular formula C23H29ClO5S and a molecular weight of 453.00 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[2-[(4-tert-butylphenyl)methyl]-4-chlorophenoxy]-6-(hydroxymethyl)thiane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[2-[(4-tert-butylphenyl)methyl]-4-chlorophenoxy]-6-(hydroxymethyl)thiane-3,4,5-triol |
|---|---|
| PubChem CID | 59771406 |
| Molecular Formula | C23H29ClO5S |
| Molecular Weight | 453.00 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[2-[(4-tert-butylphenyl)methyl]-4-chlorophenoxy]-6-(hydroxymethyl)thiane-3,4,5-triol |
| SMILES | CC(C)(C)c1ccc(Cc2cc(Cl)ccc2O[C@@H]2S[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C23H29ClO5S/c1-23(2,3)15-6-4-13(5-7-15)10-14-11-16(24)8-9-17(14)29-22-21(28)20(27)19(26)18(12-25)30-22/h4-9,11,18-22,25-28H,10,12H2,1-3H3/t18-,19-,20+,21-,22-/m1/s1 |
| InChIKey | NWIUYDCYBIWOFV-QMCAAQAGSA-N |
| XLogP | 3.12 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.00 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |