C19H23NO6S — CID 58696057
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[[4-[(4-methoxyphenyl)methyl]-3-pyridinyl]oxy]thiane-3,4,5-triol (PubChem CID 58696057) has the molecular formula C19H23NO6S and a molecular weight of 393.46 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[[4-[(4-methoxyphenyl)methyl]-3-pyridinyl]oxy]thiane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[[4-[(4-methoxyphenyl)methyl]-3-pyridinyl]oxy]thiane-3,4,5-triol |
|---|---|
| PubChem CID | 58696057 |
| Molecular Formula | C19H23NO6S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[[4-[(4-methoxyphenyl)methyl]-3-pyridinyl]oxy]thiane-3,4,5-triol |
| SMILES | COc1ccc(Cc2ccncc2O[C@@H]2S[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C19H23NO6S/c1-25-13-4-2-11(3-5-13)8-12-6-7-20-9-14(12)26-19-18(24)17(23)16(22)15(10-21)27-19/h2-7,9,15-19,21-24H,8,10H2,1H3/t15-,16-,17+,18-,19-/m1/s1 |
| InChIKey | GAXLKNHCZJRICI-UJWQCDCRSA-N |
| XLogP | 0.58 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |