C20H25NO5S — CID 58696035
(2R,3R,4S,5S,6R)-2-[[3-[(4-ethylphenyl)methyl]-2-pyridinyl]oxy]-6-(hydroxymethyl)thiane-3,4,5-triol (PubChem CID 58696035) has the molecular formula C20H25NO5S and a molecular weight of 391.49 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[[3-[(4-ethylphenyl)methyl]-2-pyridinyl]oxy]-6-(hydroxymethyl)thiane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[[3-[(4-ethylphenyl)methyl]-2-pyridinyl]oxy]-6-(hydroxymethyl)thiane-3,4,5-triol |
|---|---|
| PubChem CID | 58696035 |
| Molecular Formula | C20H25NO5S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[[3-[(4-ethylphenyl)methyl]-2-pyridinyl]oxy]-6-(hydroxymethyl)thiane-3,4,5-triol |
| SMILES | CCc1ccc(Cc2cccnc2O[C@@H]2S[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C20H25NO5S/c1-2-12-5-7-13(8-6-12)10-14-4-3-9-21-19(14)26-20-18(25)17(24)16(23)15(11-22)27-20/h3-9,15-18,20,22-25H,2,10-11H2,1H3/t15-,16-,17+,18-,20-/m1/s1 |
| InChIKey | WQCRKEDHGVHKMX-BFMVXSJESA-N |
| XLogP | 1.13 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |