C22H26O5S — CID 69199698
(2S,3R,4S,5S,6S)-2-[2-[(4-cyclopropylphenyl)methyl]phenoxy]-6-(hydroxymethyl)thiane-3,4,5-triol (PubChem CID 69199698) has the molecular formula C22H26O5S and a molecular weight of 402.51 g/mol. Its IUPAC name is (2S,3R,4S,5S,6S)-2-[2-[(4-cyclopropylphenyl)methyl]phenoxy]-6-(hydroxymethyl)thiane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5S,6S)-2-[2-[(4-cyclopropylphenyl)methyl]phenoxy]-6-(hydroxymethyl)thiane-3,4,5-triol |
|---|---|
| PubChem CID | 69199698 |
| Molecular Formula | C22H26O5S |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | (2S,3R,4S,5S,6S)-2-[2-[(4-cyclopropylphenyl)methyl]phenoxy]-6-(hydroxymethyl)thiane-3,4,5-triol |
| SMILES | OC[C@@H]1S[C@H](Oc2ccccc2Cc2ccc(C3CC3)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H26O5S/c23-12-18-19(24)20(25)21(26)22(28-18)27-17-4-2-1-3-16(17)11-13-5-7-14(8-6-13)15-9-10-15/h1-8,15,18-26H,9-12H2/t18-,19+,20-,21+,22-/m0/s1 |
| InChIKey | HOCXXMCFPARZDA-PPGORRQASA-N |
| XLogP | 2.05 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |